C18H13ClF3NO5 — CID 19008596
ethyl 7-[2-chloro-4-(trifluoromethyl)phenoxy]-3-oxo-4H-1,4-benzoxazine-2-carboxylate (PubChem CID 19008596) has the molecular formula C18H13ClF3NO5 and a molecular weight of 415.75 g/mol. Its IUPAC name is ethyl 7-[2-chloro-4-(trifluoromethyl)phenoxy]-3-oxo-4H-1,4-benzoxazine-2-carboxylate.
| Compound Name | ethyl 7-[2-chloro-4-(trifluoromethyl)phenoxy]-3-oxo-4H-1,4-benzoxazine-2-carboxylate |
|---|---|
| PubChem CID | 19008596 |
| Molecular Formula | C18H13ClF3NO5 |
| Molecular Weight | 415.75 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | ethyl 7-[2-chloro-4-(trifluoromethyl)phenoxy]-3-oxo-4H-1,4-benzoxazine-2-carboxylate |
| SMILES | CCOC(=O)C1Oc2cc(Oc3ccc(C(F)(F)F)cc3Cl)ccc2NC1=O |
| InChI | InChI=1S/C18H13ClF3NO5/c1-2-26-17(25)15-16(24)23-12-5-4-10(8-14(12)28-15)27-13-6-3-9(7-11(13)19)18(20,21)22/h3-8,15H,2H2,1H3,(H,23,24) |
| InChIKey | MBEDOUCBDWKNBJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.75 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|