C19H15ClF3NO5 — CID 19008590
methyl 7-[2-chloro-4-(trifluoromethyl)phenoxy]-2,4-dimethyl-3-oxo-1,4-benzoxazine-2-carboxylate (PubChem CID 19008590) has the molecular formula C19H15ClF3NO5 and a molecular weight of 429.78 g/mol. Its IUPAC name is methyl 7-[2-chloro-4-(trifluoromethyl)phenoxy]-2,4-dimethyl-3-oxo-1,4-benzoxazine-2-carboxylate.
| Compound Name | methyl 7-[2-chloro-4-(trifluoromethyl)phenoxy]-2,4-dimethyl-3-oxo-1,4-benzoxazine-2-carboxylate |
|---|---|
| PubChem CID | 19008590 |
| Molecular Formula | C19H15ClF3NO5 |
| Molecular Weight | 429.78 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | methyl 7-[2-chloro-4-(trifluoromethyl)phenoxy]-2,4-dimethyl-3-oxo-1,4-benzoxazine-2-carboxylate |
| SMILES | COC(=O)C1(C)Oc2cc(Oc3ccc(C(F)(F)F)cc3Cl)ccc2N(C)C1=O |
| InChI | InChI=1S/C19H15ClF3NO5/c1-18(17(26)27-3)16(25)24(2)13-6-5-11(9-15(13)29-18)28-14-7-4-10(8-12(14)20)19(21,22)23/h4-9H,1-3H3 |
| InChIKey | LCZDXWJTVDEUBE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.78 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|