C18H14ClF3N2O4 — CID 67811467
(3E)-7-[2-chloro-4-(trifluoromethyl)phenoxy]-2,4-dimethyl-3-(nitromethylidene)-1,4-benzoxazine (PubChem CID 67811467) has the molecular formula C18H14ClF3N2O4 and a molecular weight of 414.77 g/mol. Its IUPAC name is (3E)-7-[2-chloro-4-(trifluoromethyl)phenoxy]-2,4-dimethyl-3-(nitromethylidene)-1,4-benzoxazine.
| Compound Name | (3E)-7-[2-chloro-4-(trifluoromethyl)phenoxy]-2,4-dimethyl-3-(nitromethylidene)-1,4-benzoxazine |
|---|---|
| PubChem CID | 67811467 |
| Molecular Formula | C18H14ClF3N2O4 |
| Molecular Weight | 414.77 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | (3E)-7-[2-chloro-4-(trifluoromethyl)phenoxy]-2,4-dimethyl-3-(nitromethylidene)-1,4-benzoxazine |
| SMILES | CC1Oc2cc(Oc3ccc(C(F)(F)F)cc3Cl)ccc2N(C)/C1=C/[N+](=O)[O-] |
| InChI | InChI=1S/C18H14ClF3N2O4/c1-10-15(9-24(25)26)23(2)14-5-4-12(8-17(14)27-10)28-16-6-3-11(7-13(16)19)18(20,21)22/h3-10H,1-2H3/b15-9+ |
| InChIKey | PADMIMFFZZBVIF-OQLLNIDSSA-N |
| XLogP | 5.49 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.77 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|