C11H10F3NO2 — CID 118325292
2-ethyl-7-(trifluoromethyl)-4H-1,4-benzoxazin-3-one (PubChem CID 118325292) has the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. Its IUPAC name is 2-ethyl-7-(trifluoromethyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 2-ethyl-7-(trifluoromethyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 118325292 |
| Molecular Formula | C11H10F3NO2 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2-ethyl-7-(trifluoromethyl)-4H-1,4-benzoxazin-3-one |
| SMILES | CCC1Oc2cc(C(F)(F)F)ccc2NC1=O |
| InChI | InChI=1S/C11H10F3NO2/c1-2-8-10(16)15-7-4-3-6(11(12,13)14)5-9(7)17-8/h3-5,8H,2H2,1H3,(H,15,16) |
| InChIKey | YCZGBZDUXLGMCW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |