C21H17ClF3NO7 — CID 151661373
ethoxycarbonyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-3-(2-methylprop-2-enyl)-2-nitrobenzoate (PubChem CID 151661373) has the molecular formula C21H17ClF3NO7 and a molecular weight of 487.81 g/mol. Its IUPAC name is ethoxycarbonyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-3-(2-methylprop-2-enyl)-2-nitrobenzoate.
| Compound Name | ethoxycarbonyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-3-(2-methylprop-2-enyl)-2-nitrobenzoate |
|---|---|
| PubChem CID | 151661373 |
| Molecular Formula | C21H17ClF3NO7 |
| Molecular Weight | 487.81 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | ethoxycarbonyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-3-(2-methylprop-2-enyl)-2-nitrobenzoate |
| SMILES | C=C(C)Cc1cc(Oc2ccc(C(F)(F)F)cc2Cl)cc(C(=O)OC(=O)OCC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H17ClF3NO7/c1-4-31-20(28)33-19(27)15-10-14(8-12(7-11(2)3)18(15)26(29)30)32-17-6-5-13(9-16(17)22)21(23,24)25/h5-6,8-10H,2,4,7H2,1,3H3 |
| InChIKey | QWPMQGBFQKMJNX-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.81 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|