C16H10ClF3N2O6 — CID 70488428
methyl 3-carbamoyl-5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate (PubChem CID 70488428) has the molecular formula C16H10ClF3N2O6 and a molecular weight of 418.71 g/mol. Its IUPAC name is methyl 3-carbamoyl-5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate.
| Compound Name | methyl 3-carbamoyl-5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
|---|---|
| PubChem CID | 70488428 |
| Molecular Formula | C16H10ClF3N2O6 |
| Molecular Weight | 418.71 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | methyl 3-carbamoyl-5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
| SMILES | COC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)cc(C(N)=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H10ClF3N2O6/c1-27-15(24)10-6-8(5-9(14(21)23)13(10)22(25)26)28-12-3-2-7(4-11(12)17)16(18,19)20/h2-6H,1H3,(H2,21,23) |
| InChIKey | ADNIWKITFNHKBM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.71 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|