C15H8F3N2O2- — CID 154461404
1-[3-(trifluoromethyl)phenyl]indazole-5-carboxylate (PubChem CID 154461404) has the molecular formula C15H8F3N2O2- and a molecular weight of 305.24 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenyl]indazole-5-carboxylate.
| Compound Name | 1-[3-(trifluoromethyl)phenyl]indazole-5-carboxylate |
|---|---|
| PubChem CID | 154461404 |
| Molecular Formula | C15H8F3N2O2- |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenyl]indazole-5-carboxylate |
| SMILES | O=C([O-])c1ccc2c(cnn2-c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C15H9F3N2O2/c16-15(17,18)11-2-1-3-12(7-11)20-13-5-4-9(14(21)22)6-10(13)8-19-20/h1-8H,(H,21,22)/p-1 |
| InChIKey | NODOVXIFZAZNGO-UHFFFAOYSA-M |
| XLogP | 2.41 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |