C13H8Br2Cl2F3N3 — CID 58012467
4-(2,2-dibromocyclopropyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-amine (PubChem CID 58012467) has the molecular formula C13H8Br2Cl2F3N3 and a molecular weight of 493.94 g/mol. Its IUPAC name is 4-(2,2-dibromocyclopropyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-amine.
| Compound Name | 4-(2,2-dibromocyclopropyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 58012467 |
| Molecular Formula | C13H8Br2Cl2F3N3 |
| Molecular Weight | 493.94 g/mol |
| Exact Mass | 490.84 |
| IUPAC Name | 4-(2,2-dibromocyclopropyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-amine |
| SMILES | Nc1c(C2CC2(Br)Br)cnn1-c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H8Br2Cl2F3N3/c14-12(15)3-7(12)6-4-22-23(11(6)21)10-8(16)1-5(2-9(10)17)13(18,19)20/h1-2,4,7H,3,21H2 |
| InChIKey | VDAQTTNNDVVPOQ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.94 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|