C11H5Cl2F4N3O — CID 22618567
5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-fluoropyrazole-4-carbaldehyde (PubChem CID 22618567) has the molecular formula C11H5Cl2F4N3O and a molecular weight of 342.08 g/mol. Its IUPAC name is 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-fluoropyrazole-4-carbaldehyde.
| Compound Name | 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-fluoropyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 22618567 |
| Molecular Formula | C11H5Cl2F4N3O |
| Molecular Weight | 342.08 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-fluoropyrazole-4-carbaldehyde |
| SMILES | Nc1c(C=O)c(F)nn1-c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H5Cl2F4N3O/c12-6-1-4(11(15,16)17)2-7(13)8(6)20-10(18)5(3-21)9(14)19-20/h1-3H,18H2 |
| InChIKey | SWSFATJWLUURIT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.08 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|