C12H6Cl2F3N5O — CID 19356482
5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[(E)-hydroxyiminomethyl]pyrazole-3-carbonitrile (PubChem CID 19356482) has the molecular formula C12H6Cl2F3N5O and a molecular weight of 364.11 g/mol. Its IUPAC name is 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[(E)-hydroxyiminomethyl]pyrazole-3-carbonitrile.
| Compound Name | 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[(E)-hydroxyiminomethyl]pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 19356482 |
| Molecular Formula | C12H6Cl2F3N5O |
| Molecular Weight | 364.11 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[(E)-hydroxyiminomethyl]pyrazole-3-carbonitrile |
| SMILES | N#Cc1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c(N)c1/C=N/O |
| InChI | InChI=1S/C12H6Cl2F3N5O/c13-7-1-5(12(15,16)17)2-8(14)10(7)22-11(19)6(4-20-23)9(3-18)21-22/h1-2,4,23H,19H2/b20-4+ |
| InChIKey | WGWAOYMNJLGXMQ-LRNAUUFOSA-N |
| XLogP | 3.46 |
| TPSA | 100.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.11 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|