C15H9Cl2F3N4O — CID 23227970
5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(4-hydroxybut-1-ynyl)pyrazole-3-carbonitrile (PubChem CID 23227970) has the molecular formula C15H9Cl2F3N4O and a molecular weight of 389.16 g/mol. Its IUPAC name is 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(4-hydroxybut-1-ynyl)pyrazole-3-carbonitrile.
| Compound Name | 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(4-hydroxybut-1-ynyl)pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 23227970 |
| Molecular Formula | C15H9Cl2F3N4O |
| Molecular Weight | 389.16 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(4-hydroxybut-1-ynyl)pyrazole-3-carbonitrile |
| SMILES | N#Cc1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c(N)c1C#CCCO |
| InChI | InChI=1S/C15H9Cl2F3N4O/c16-10-5-8(15(18,19)20)6-11(17)13(10)24-14(22)9(3-1-2-4-25)12(7-21)23-24/h5-6,25H,2,4,22H2 |
| InChIKey | AHFFFTDCHRORMH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 87.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.16 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|