C16H13Cl2F3N4OSi — CID 21188108
5-amino-1-[2,6-dichloro-4-(trifluoromethoxy)phenyl]-4-(2-trimethylsilylethynyl)pyrazole-3-carbonitrile (PubChem CID 21188108) has the molecular formula C16H13Cl2F3N4OSi and a molecular weight of 433.29 g/mol. Its IUPAC name is 5-amino-1-[2,6-dichloro-4-(trifluoromethoxy)phenyl]-4-(2-trimethylsilylethynyl)pyrazole-3-carbonitrile.
| Compound Name | 5-amino-1-[2,6-dichloro-4-(trifluoromethoxy)phenyl]-4-(2-trimethylsilylethynyl)pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 21188108 |
| Molecular Formula | C16H13Cl2F3N4OSi |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 5-amino-1-[2,6-dichloro-4-(trifluoromethoxy)phenyl]-4-(2-trimethylsilylethynyl)pyrazole-3-carbonitrile |
| SMILES | C[Si](C)(C)C#Cc1c(C#N)nn(-c2c(Cl)cc(OC(F)(F)F)cc2Cl)c1N |
| InChI | InChI=1S/C16H13Cl2F3N4OSi/c1-27(2,3)5-4-10-13(8-22)24-25(15(10)23)14-11(17)6-9(7-12(14)18)26-16(19,20)21/h6-7H,23H2,1-3H3 |
| InChIKey | AVUQLHHSYGIFES-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|