C14H10Cl2F3N5O — CID 57282356
5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[1-(methoxyamino)ethenyl]pyrazole-3-carbonitrile (PubChem CID 57282356) has the molecular formula C14H10Cl2F3N5O and a molecular weight of 392.17 g/mol. Its IUPAC name is 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[1-(methoxyamino)ethenyl]pyrazole-3-carbonitrile.
| Compound Name | 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[1-(methoxyamino)ethenyl]pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 57282356 |
| Molecular Formula | C14H10Cl2F3N5O |
| Molecular Weight | 392.17 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[1-(methoxyamino)ethenyl]pyrazole-3-carbonitrile |
| SMILES | C=C(NOC)c1c(C#N)nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c1N |
| InChI | InChI=1S/C14H10Cl2F3N5O/c1-6(23-25-2)11-10(5-20)22-24(13(11)21)12-8(15)3-7(4-9(12)16)14(17,18)19/h3-4,23H,1,21H2,2H3 |
| InChIKey | JPPUWKFQYBKNSK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.17 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|