C11H6Cl3F3N3O2S- — CID 174282954
[5-amino-3-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl]methanesulfinate (PubChem CID 174282954) has the molecular formula C11H6Cl3F3N3O2S- and a molecular weight of 407.61 g/mol. Its IUPAC name is [5-amino-3-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl]methanesulfinate.
| Compound Name | [5-amino-3-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl]methanesulfinate |
|---|---|
| PubChem CID | 174282954 |
| Molecular Formula | C11H6Cl3F3N3O2S- |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 405.92 |
| IUPAC Name | [5-amino-3-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl]methanesulfinate |
| SMILES | Nc1c(CS(=O)[O-])c(Cl)nn1-c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H7Cl3F3N3O2S/c12-6-1-4(11(15,16)17)2-7(13)8(6)20-10(18)5(3-23(21)22)9(14)19-20/h1-2H,3,18H2,(H,21,22)/p-1 |
| InChIKey | UMNVQBCHUSURQS-UHFFFAOYSA-M |
| XLogP | 3.81 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|