C12H10Cl2F3N5O2S — CID 135696656
5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-N'-hydroxy-4-methylsulfinylpyrazole-3-carboximidamide (PubChem CID 135696656) has the molecular formula C12H10Cl2F3N5O2S and a molecular weight of 416.21 g/mol. Its IUPAC name is 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-N'-hydroxy-4-methylsulfinylpyrazole-3-carboximidamide.
| Compound Name | 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-N'-hydroxy-4-methylsulfinylpyrazole-3-carboximidamide |
|---|---|
| PubChem CID | 135696656 |
| Molecular Formula | C12H10Cl2F3N5O2S |
| Molecular Weight | 416.21 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-N'-hydroxy-4-methylsulfinylpyrazole-3-carboximidamide |
| SMILES | CS(=O)c1c(/C(N)=N\O)nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c1N |
| InChI | InChI=1S/C12H10Cl2F3N5O2S/c1-25(24)9-7(10(18)21-23)20-22(11(9)19)8-5(13)2-4(3-6(8)14)12(15,16)17/h2-3,23H,19H2,1H3,(H2,18,21) |
| InChIKey | DWVDRUFILFFHBN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.21 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|