C14H12Cl3F3N6O2S — CID 154042357
N-[(E)-[amino-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazol-3-yl]methylidene]amino]-2-chloroacetamide (PubChem CID 154042357) has the molecular formula C14H12Cl3F3N6O2S and a molecular weight of 491.71 g/mol. Its IUPAC name is N-[(E)-[amino-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazol-3-yl]methylidene]amino]-2-chloroacetamide.
| Compound Name | N-[(E)-[amino-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazol-3-yl]methylidene]amino]-2-chloroacetamide |
|---|---|
| PubChem CID | 154042357 |
| Molecular Formula | C14H12Cl3F3N6O2S |
| Molecular Weight | 491.71 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | N-[(E)-[amino-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazol-3-yl]methylidene]amino]-2-chloroacetamide |
| SMILES | CS(=O)c1c(/C(N)=N\NC(=O)CCl)nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c1N |
| InChI | InChI=1S/C14H12Cl3F3N6O2S/c1-29(28)11-9(12(21)24-23-8(27)4-15)25-26(13(11)22)10-6(16)2-5(3-7(10)17)14(18,19)20/h2-3H,4,22H2,1H3,(H2,21,24)(H,23,27) |
| InChIKey | ZAGNZKYJSCGQGK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.71 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|