C20H25Cl2F3N6O2S — CID 153275835
N-[(E)-[amino-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazol-3-yl]methylidene]amino]octanamide (PubChem CID 153275835) has the molecular formula C20H25Cl2F3N6O2S and a molecular weight of 541.43 g/mol. Its IUPAC name is N-[(E)-[amino-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazol-3-yl]methylidene]amino]octanamide.
| Compound Name | N-[(E)-[amino-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazol-3-yl]methylidene]amino]octanamide |
|---|---|
| PubChem CID | 153275835 |
| Molecular Formula | C20H25Cl2F3N6O2S |
| Molecular Weight | 541.43 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | N-[(E)-[amino-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazol-3-yl]methylidene]amino]octanamide |
| SMILES | CCCCCCCC(=O)N/N=C(/N)c1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c(N)c1S(C)=O |
| InChI | InChI=1S/C20H25Cl2F3N6O2S/c1-3-4-5-6-7-8-14(32)28-29-18(26)15-17(34(2)33)19(27)31(30-15)16-12(21)9-11(10-13(16)22)20(23,24)25/h9-10H,3-8,27H2,1-2H3,(H2,26,29)(H,28,32) |
| InChIKey | RIDHVYNHCFERND-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|