C20H15Cl2F3N4O3S — CID 54551100
[[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazol-3-yl]methylideneamino] 2-methylbenzoate (PubChem CID 54551100) has the molecular formula C20H15Cl2F3N4O3S and a molecular weight of 519.33 g/mol. Its IUPAC name is [[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazol-3-yl]methylideneamino] 2-methylbenzoate.
| Compound Name | [[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazol-3-yl]methylideneamino] 2-methylbenzoate |
|---|---|
| PubChem CID | 54551100 |
| Molecular Formula | C20H15Cl2F3N4O3S |
| Molecular Weight | 519.33 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | [[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazol-3-yl]methylideneamino] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)ON=Cc1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c(N)c1S(C)=O |
| InChI | InChI=1S/C20H15Cl2F3N4O3S/c1-10-5-3-4-6-12(10)19(30)32-27-9-15-17(33(2)31)18(26)29(28-15)16-13(21)7-11(8-14(16)22)20(23,24)25/h3-9H,26H2,1-2H3 |
| InChIKey | ZJZBQGAEZWVQEU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.33 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|