C14H11Cl2F3N4O3S — CID 54069500
[[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfanylpyrazol-3-yl]methylideneamino] methyl carbonate (PubChem CID 54069500) has the molecular formula C14H11Cl2F3N4O3S and a molecular weight of 443.23 g/mol. Its IUPAC name is [[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfanylpyrazol-3-yl]methylideneamino] methyl carbonate.
| Compound Name | [[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfanylpyrazol-3-yl]methylideneamino] methyl carbonate |
|---|---|
| PubChem CID | 54069500 |
| Molecular Formula | C14H11Cl2F3N4O3S |
| Molecular Weight | 443.23 g/mol |
| Exact Mass | 441.99 |
| IUPAC Name | [[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfanylpyrazol-3-yl]methylideneamino] methyl carbonate |
| SMILES | COC(=O)ON=Cc1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c(N)c1SC |
| InChI | InChI=1S/C14H11Cl2F3N4O3S/c1-25-13(24)26-21-5-9-11(27-2)12(20)23(22-9)10-7(15)3-6(4-8(10)16)14(17,18)19/h3-5H,20H2,1-2H3 |
| InChIKey | MFJWNEPHTYWSPJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.23 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|