C13H10Cl2F3N3O3S — CID 135696630
(NE)-N-[[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-methyl-4-methylsulfonylpyrazol-3-yl]methylidene]hydroxylamine (PubChem CID 135696630) has the molecular formula C13H10Cl2F3N3O3S and a molecular weight of 416.21 g/mol. Its IUPAC name is (NE)-N-[[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-methyl-4-methylsulfonylpyrazol-3-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-methyl-4-methylsulfonylpyrazol-3-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 135696630 |
| Molecular Formula | C13H10Cl2F3N3O3S |
| Molecular Weight | 416.21 g/mol |
| Exact Mass | 414.98 |
| IUPAC Name | (NE)-N-[[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-methyl-4-methylsulfonylpyrazol-3-yl]methylidene]hydroxylamine |
| SMILES | Cc1c(S(C)(=O)=O)c(/C=N/O)nn1-c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H10Cl2F3N3O3S/c1-6-12(25(2,23)24)10(5-19-22)20-21(6)11-8(14)3-7(4-9(11)15)13(16,17)18/h3-5,22H,1-2H3/b19-5+ |
| InChIKey | GBSDTGATUBNQTH-PTXOJBNSSA-N |
| XLogP | 3.72 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.21 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|