C10H5Cl2F3N4O — CID 154110999
N-[[2-[2,6-dichloro-4-(trifluoromethyl)phenyl]triazol-4-yl]methylidene]hydroxylamine (PubChem CID 154110999) has the molecular formula C10H5Cl2F3N4O and a molecular weight of 325.08 g/mol. Its IUPAC name is N-[[2-[2,6-dichloro-4-(trifluoromethyl)phenyl]triazol-4-yl]methylidene]hydroxylamine.
| Compound Name | N-[[2-[2,6-dichloro-4-(trifluoromethyl)phenyl]triazol-4-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 154110999 |
| Molecular Formula | C10H5Cl2F3N4O |
| Molecular Weight | 325.08 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | N-[[2-[2,6-dichloro-4-(trifluoromethyl)phenyl]triazol-4-yl]methylidene]hydroxylamine |
| SMILES | ON=Cc1cnn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)n1 |
| InChI | InChI=1S/C10H5Cl2F3N4O/c11-7-1-5(10(13,14)15)2-8(12)9(7)19-16-3-6(18-19)4-17-20/h1-4,20H |
| InChIKey | CWJDSAMEDPIPPR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.08 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|