C11H3Cl2F6N3O — CID 19778414
2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)triazole-4-carbaldehyde (PubChem CID 19778414) has the molecular formula C11H3Cl2F6N3O and a molecular weight of 378.06 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)triazole-4-carbaldehyde.
| Compound Name | 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 19778414 |
| Molecular Formula | C11H3Cl2F6N3O |
| Molecular Weight | 378.06 g/mol |
| Exact Mass | 376.96 |
| IUPAC Name | 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)triazole-4-carbaldehyde |
| SMILES | O=Cc1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)nc1C(F)(F)F |
| InChI | InChI=1S/C11H3Cl2F6N3O/c12-5-1-4(10(14,15)16)2-6(13)8(5)22-20-7(3-23)9(21-22)11(17,18)19/h1-3H |
| InChIKey | JFSXMZJFIAPAQF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.06 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|