About 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)pyrazolo[3,4-d]pyrimidine
2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)pyrazolo[3,4-d]pyrimidine (PubChem CID 154465784) has the molecular formula C13H4Cl2F6N4
and a molecular weight of 401.10 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)pyrazolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)pyrazolo[3,4-d]pyrimidine |
| PubChem CID | 154465784 |
| Molecular Formula | C13H4Cl2F6N4 |
| Molecular Weight | 401.10 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)pyrazolo[3,4-d]pyrimidine |
| SMILES | FC(F)(F)c1cc(Cl)c(-n2cc3c(C(F)(F)F)ncnc3n2)c(Cl)c1 |
| InChI | InChI=1S/C13H4Cl2F6N4/c14-7-1-5(12(16,17)18)2-8(15)9(7)25-3-6-10(13(19,20)21)22-4-23-11(6)24-25/h1-4H |
| InChIKey | GQVJXTZIZIKPEA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.10 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)pyrazolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)pyrazolo[3,4-d]pyrimidine?
The IUPAC name of 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)pyrazolo[3,4-d]pyrimidine (CID 154465784) is 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)pyrazolo[3,4-d]pyrimidine.
What is the SMILES notation for 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)pyrazolo[3,4-d]pyrimidine?
The canonical SMILES for 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)pyrazolo[3,4-d]pyrimidine is FC(F)(F)c1cc(Cl)c(-n2cc3c(C(F)(F)F)ncnc3n2)c(Cl)c1.
What is the InChIKey of 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)pyrazolo[3,4-d]pyrimidine?
The InChIKey is GQVJXTZIZIKPEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H4Cl2F6N4/c14-7-1-5(12(16,17)18)2-8(15)9(7)25-3-6-10(13(19,20)21)22-4-23-11(6)24-25/h1-4H.
What are the key properties of 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)pyrazolo[3,4-d]pyrimidine?
2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)pyrazolo[3,4-d]pyrimidine has a molecular weight of 401.10 g/mol, XLogP of 5.16, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)pyrazolo[3,4-d]pyrimidine is sourced from PubChem (CID 154465784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).