About 4-(2-bromoethynyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylpyrazole
4-(2-bromoethynyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylpyrazole (PubChem CID 21188138) has the molecular formula C13H6BrCl2F3N2
and a molecular weight of 398.01 g/mol. Its IUPAC name is 4-(2-bromoethynyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylpyrazole.
Molecular Properties
| Compound Name | 4-(2-bromoethynyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylpyrazole |
| PubChem CID | 21188138 |
| Molecular Formula | C13H6BrCl2F3N2 |
| Molecular Weight | 398.01 g/mol |
| Exact Mass | 395.90 |
| IUPAC Name | 4-(2-bromoethynyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylpyrazole |
| SMILES | Cc1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)cc1C#CBr |
| InChI | InChI=1S/C13H6BrCl2F3N2/c1-7-8(2-3-14)6-21(20-7)12-10(15)4-9(5-11(12)16)13(17,18)19/h4-6H,1H3 |
| InChIKey | JUJYCRUKZUQADL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.01 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-bromoethynyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromoethynyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylpyrazole?
The IUPAC name of 4-(2-bromoethynyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylpyrazole (CID 21188138) is 4-(2-bromoethynyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylpyrazole.
What is the SMILES notation for 4-(2-bromoethynyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylpyrazole?
The canonical SMILES for 4-(2-bromoethynyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylpyrazole is Cc1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)cc1C#CBr.
What is the InChIKey of 4-(2-bromoethynyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylpyrazole?
The InChIKey is JUJYCRUKZUQADL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6BrCl2F3N2/c1-7-8(2-3-14)6-21(20-7)12-10(15)4-9(5-11(12)16)13(17,18)19/h4-6H,1H3.
What are the key properties of 4-(2-bromoethynyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylpyrazole?
4-(2-bromoethynyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylpyrazole has a molecular weight of 398.01 g/mol, XLogP of 5.21, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromoethynyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylpyrazole is sourced from PubChem (CID 21188138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).