C13H6BrCl2F3N2 — CID 21188138
4-(2-bromoethynyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylpyrazole (PubChem CID 21188138) has the molecular formula C13H6BrCl2F3N2 and a molecular weight of 398.01 g/mol. Its IUPAC name is 4-(2-bromoethynyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylpyrazole.
| Compound Name | 4-(2-bromoethynyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylpyrazole |
|---|---|
| PubChem CID | 21188138 |
| Molecular Formula | C13H6BrCl2F3N2 |
| Molecular Weight | 398.01 g/mol |
| Exact Mass | 395.90 |
| IUPAC Name | 4-(2-bromoethynyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylpyrazole |
| SMILES | Cc1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)cc1C#CBr |
| InChI | InChI=1S/C13H6BrCl2F3N2/c1-7-8(2-3-14)6-21(20-7)12-10(15)4-9(5-11(12)16)13(17,18)19/h4-6H,1H3 |
| InChIKey | JUJYCRUKZUQADL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.01 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|