C9H4Cl2F3N3 — CID 91517519
1-[2,6-dichloro-4-(trifluoromethyl)phenyl]triazole (PubChem CID 91517519) has the molecular formula C9H4Cl2F3N3 and a molecular weight of 282.05 g/mol. Its IUPAC name is 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]triazole.
| Compound Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]triazole |
|---|---|
| PubChem CID | 91517519 |
| Molecular Formula | C9H4Cl2F3N3 |
| Molecular Weight | 282.05 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]triazole |
| SMILES | FC(F)(F)c1cc(Cl)c(-n2ccnn2)c(Cl)c1 |
| InChI | InChI=1S/C9H4Cl2F3N3/c10-6-3-5(9(12,13)14)4-7(11)8(6)17-2-1-15-16-17/h1-4H |
| InChIKey | FAAGPGBBQGNSEJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.05 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |