C12H3Cl3F6N2O — CID 141466675
1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-(trifluoromethyl)pyrazole-4-carbonyl chloride (PubChem CID 141466675) has the molecular formula C12H3Cl3F6N2O and a molecular weight of 411.52 g/mol. Its IUPAC name is 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-(trifluoromethyl)pyrazole-4-carbonyl chloride.
| Compound Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-(trifluoromethyl)pyrazole-4-carbonyl chloride |
|---|---|
| PubChem CID | 141466675 |
| Molecular Formula | C12H3Cl3F6N2O |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 409.92 |
| IUPAC Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-(trifluoromethyl)pyrazole-4-carbonyl chloride |
| SMILES | O=C(Cl)c1cn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)nc1C(F)(F)F |
| InChI | InChI=1S/C12H3Cl3F6N2O/c13-6-1-4(11(16,17)18)2-7(14)8(6)23-3-5(10(15)24)9(22-23)12(19,20)21/h1-3H |
| InChIKey | AUMUSIJUFDLAQC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|