About [3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl] thiocyanate
[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl] thiocyanate (PubChem CID 150831946) has the molecular formula C12H3Cl2F3N4S
and a molecular weight of 363.15 g/mol. Its IUPAC name is [3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl] thiocyanate.
Molecular Properties
| Compound Name | [3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl] thiocyanate |
| PubChem CID | 150831946 |
| Molecular Formula | C12H3Cl2F3N4S |
| Molecular Weight | 363.15 g/mol |
| Exact Mass | 361.94 |
| IUPAC Name | [3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl] thiocyanate |
| SMILES | N#CSc1cn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)nc1C#N |
| InChI | InChI=1S/C12H3Cl2F3N4S/c13-7-1-6(12(15,16)17)2-8(14)11(7)21-4-10(22-5-19)9(3-18)20-21/h1-2,4H |
| InChIKey | KMDORIYZSIGRGG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.15 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl] thiocyanate?
The IUPAC name of [3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl] thiocyanate (CID 150831946) is [3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl] thiocyanate.
What is the SMILES notation for [3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl] thiocyanate?
The canonical SMILES for [3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl] thiocyanate is N#CSc1cn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)nc1C#N.
What is the InChIKey of [3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl] thiocyanate?
The InChIKey is KMDORIYZSIGRGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H3Cl2F3N4S/c13-7-1-6(12(15,16)17)2-8(14)11(7)21-4-10(22-5-19)9(3-18)20-21/h1-2,4H.
What are the key properties of [3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl] thiocyanate?
[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl] thiocyanate has a molecular weight of 363.15 g/mol, XLogP of 4.64, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl] thiocyanate is sourced from PubChem (CID 150831946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).