C14H5Cl2F3N4 — CID 57202178
4-(2-cyanoethenyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-3-carbonitrile (PubChem CID 57202178) has the molecular formula C14H5Cl2F3N4 and a molecular weight of 357.12 g/mol. Its IUPAC name is 4-(2-cyanoethenyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-3-carbonitrile.
| Compound Name | 4-(2-cyanoethenyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 57202178 |
| Molecular Formula | C14H5Cl2F3N4 |
| Molecular Weight | 357.12 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 4-(2-cyanoethenyl)-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-3-carbonitrile |
| SMILES | N#CC=Cc1cn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)nc1C#N |
| InChI | InChI=1S/C14H5Cl2F3N4/c15-10-4-9(14(17,18)19)5-11(16)13(10)23-7-8(2-1-3-20)12(6-21)22-23/h1-2,4-5,7H |
| InChIKey | SJYARLHVWFTUIM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.12 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|