C13H8Cl3F3N2 — CID 18614754
4-chloro-2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5,6-dihydro-4H-cyclopenta[c]pyrazole (PubChem CID 18614754) has the molecular formula C13H8Cl3F3N2 and a molecular weight of 355.57 g/mol. Its IUPAC name is 4-chloro-2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5,6-dihydro-4H-cyclopenta[c]pyrazole.
| Compound Name | 4-chloro-2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5,6-dihydro-4H-cyclopenta[c]pyrazole |
|---|---|
| PubChem CID | 18614754 |
| Molecular Formula | C13H8Cl3F3N2 |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | 4-chloro-2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5,6-dihydro-4H-cyclopenta[c]pyrazole |
| SMILES | FC(F)(F)c1cc(Cl)c(-n2cc3c(n2)CCC3Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H8Cl3F3N2/c14-8-1-2-11-7(8)5-21(20-11)12-9(15)3-6(4-10(12)16)13(17,18)19/h3-5,8H,1-2H2 |
| InChIKey | GPGACSDRHVLVNA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|