C14H13Cl2F3N2O — CID 174247118
2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-propan-2-yl-3,4-dihydropyrazole-3-carbaldehyde (PubChem CID 174247118) has the molecular formula C14H13Cl2F3N2O and a molecular weight of 353.17 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-propan-2-yl-3,4-dihydropyrazole-3-carbaldehyde.
| Compound Name | 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-propan-2-yl-3,4-dihydropyrazole-3-carbaldehyde |
|---|---|
| PubChem CID | 174247118 |
| Molecular Formula | C14H13Cl2F3N2O |
| Molecular Weight | 353.17 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-propan-2-yl-3,4-dihydropyrazole-3-carbaldehyde |
| SMILES | CC(C)C1=NN(c2c(Cl)cc(C(F)(F)F)cc2Cl)C(C=O)C1 |
| InChI | InChI=1S/C14H13Cl2F3N2O/c1-7(2)12-5-9(6-22)21(20-12)13-10(15)3-8(4-11(13)16)14(17,18)19/h3-4,6-7,9H,5H2,1-2H3 |
| InChIKey | YXXBVRXUDIENHK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.17 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|