C15H7Cl2F3N6 — CID 67863005
(Z)-2-amino-3-[[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl]methylideneamino]but-2-enedinitrile (PubChem CID 67863005) has the molecular formula C15H7Cl2F3N6 and a molecular weight of 399.16 g/mol. Its IUPAC name is (Z)-2-amino-3-[[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl]methylideneamino]but-2-enedinitrile.
| Compound Name | (Z)-2-amino-3-[[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl]methylideneamino]but-2-enedinitrile |
|---|---|
| PubChem CID | 67863005 |
| Molecular Formula | C15H7Cl2F3N6 |
| Molecular Weight | 399.16 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | (Z)-2-amino-3-[[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-4-yl]methylideneamino]but-2-enedinitrile |
| SMILES | N#C/C(N)=C(C#N)/N=C/c1cnn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C15H7Cl2F3N6/c16-10-1-9(15(18,19)20)2-11(17)14(10)26-7-8(6-25-26)5-24-13(4-22)12(23)3-21/h1-2,5-7H,23H2/b13-12-,24-5+ |
| InChIKey | JGOBPAITGXSBAD-RCOAYCGBSA-N |
| XLogP | 3.83 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.16 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|