C18H7Cl2F6N5O — CID 88503015
(Z)-2-amino-3-[[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-6-oxo-4-(trifluoromethyl)-3-pyridinyl]methylideneamino]but-2-enedinitrile (PubChem CID 88503015) has the molecular formula C18H7Cl2F6N5O and a molecular weight of 494.18 g/mol. Its IUPAC name is (Z)-2-amino-3-[[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-6-oxo-4-(trifluoromethyl)-3-pyridinyl]methylideneamino]but-2-enedinitrile.
| Compound Name | (Z)-2-amino-3-[[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-6-oxo-4-(trifluoromethyl)-3-pyridinyl]methylideneamino]but-2-enedinitrile |
|---|---|
| PubChem CID | 88503015 |
| Molecular Formula | C18H7Cl2F6N5O |
| Molecular Weight | 494.18 g/mol |
| Exact Mass | 492.99 |
| IUPAC Name | (Z)-2-amino-3-[[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-6-oxo-4-(trifluoromethyl)-3-pyridinyl]methylideneamino]but-2-enedinitrile |
| SMILES | N#C/C(N)=C(C#N)/N=C/c1cn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c(=O)cc1C(F)(F)F |
| InChI | InChI=1S/C18H7Cl2F6N5O/c19-11-1-9(17(21,22)23)2-12(20)16(11)31-7-8(6-30-14(5-28)13(29)4-27)10(3-15(31)32)18(24,25)26/h1-3,6-7H,29H2/b14-13-,30-6+ |
| InChIKey | XMQGHYREQUOFMF-SZEJNQPISA-N |
| XLogP | 4.82 |
| TPSA | 107.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.18 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|