C10H6ClF6N3O — CID 168532972
[[2-chloro-4,6-bis(trifluoromethyl)phenyl]methylideneamino]urea (PubChem CID 168532972) has the molecular formula C10H6ClF6N3O and a molecular weight of 333.62 g/mol. Its IUPAC name is [[2-chloro-4,6-bis(trifluoromethyl)phenyl]methylideneamino]urea.
| Compound Name | [[2-chloro-4,6-bis(trifluoromethyl)phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168532972 |
| Molecular Formula | C10H6ClF6N3O |
| Molecular Weight | 333.62 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | [[2-chloro-4,6-bis(trifluoromethyl)phenyl]methylideneamino]urea |
| SMILES | NC(=O)NN=Cc1c(Cl)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C10H6ClF6N3O/c11-7-2-4(9(12,13)14)1-6(10(15,16)17)5(7)3-19-20-8(18)21/h1-3H,(H3,18,20,21) |
| InChIKey | IYVVUOMSOBNWOH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.62 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|