C14H8ClF3IN3O2 — CID 168549842
methyl 3-amino-1-[2-chloro-6-iodo-4-(trifluoromethyl)phenyl]-4-cyanopyrrole-2-carboxylate (PubChem CID 168549842) has the molecular formula C14H8ClF3IN3O2 and a molecular weight of 469.59 g/mol. Its IUPAC name is methyl 3-amino-1-[2-chloro-6-iodo-4-(trifluoromethyl)phenyl]-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-[2-chloro-6-iodo-4-(trifluoromethyl)phenyl]-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168549842 |
| Molecular Formula | C14H8ClF3IN3O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 468.93 |
| IUPAC Name | methyl 3-amino-1-[2-chloro-6-iodo-4-(trifluoromethyl)phenyl]-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1c(Cl)cc(C(F)(F)F)cc1I |
| InChI | InChI=1S/C14H8ClF3IN3O2/c1-24-13(23)12-10(21)6(4-20)5-22(12)11-8(15)2-7(3-9(11)19)14(16,17)18/h2-3,5H,21H2,1H3 |
| InChIKey | YDXJCXOASOOGFQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|