C14H8ClIN4O2 — CID 168546792
methyl 3-amino-1-(2-chloro-4-cyano-6-iodophenyl)-4-cyanopyrrole-2-carboxylate (PubChem CID 168546792) has the molecular formula C14H8ClIN4O2 and a molecular weight of 426.60 g/mol. Its IUPAC name is methyl 3-amino-1-(2-chloro-4-cyano-6-iodophenyl)-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-(2-chloro-4-cyano-6-iodophenyl)-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168546792 |
| Molecular Formula | C14H8ClIN4O2 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 425.94 |
| IUPAC Name | methyl 3-amino-1-(2-chloro-4-cyano-6-iodophenyl)-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1c(Cl)cc(C#N)cc1I |
| InChI | InChI=1S/C14H8ClIN4O2/c1-22-14(21)13-11(19)8(5-18)6-20(13)12-9(15)2-7(4-17)3-10(12)16/h2-3,6H,19H2,1H3 |
| InChIKey | MKERRMCUNJEQLD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|