C13H7Cl4N3O2 — CID 168546358
methyl 3-amino-4-cyano-1-(2,3,4,5-tetrachlorophenyl)pyrrole-2-carboxylate (PubChem CID 168546358) has the molecular formula C13H7Cl4N3O2 and a molecular weight of 379.03 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(2,3,4,5-tetrachlorophenyl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(2,3,4,5-tetrachlorophenyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168546358 |
| Molecular Formula | C13H7Cl4N3O2 |
| Molecular Weight | 379.03 g/mol |
| Exact Mass | 376.93 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(2,3,4,5-tetrachlorophenyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cc(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H7Cl4N3O2/c1-22-13(21)12-11(19)5(3-18)4-20(12)7-2-6(14)8(15)10(17)9(7)16/h2,4H,19H2,1H3 |
| InChIKey | AZGJFJLMYDLPBZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.03 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|