C15H11ClN4O2 — CID 168549836
methyl 3-amino-1-(5-chloro-2-cyano-4-methylphenyl)-4-cyanopyrrole-2-carboxylate (PubChem CID 168549836) has the molecular formula C15H11ClN4O2 and a molecular weight of 314.73 g/mol. Its IUPAC name is methyl 3-amino-1-(5-chloro-2-cyano-4-methylphenyl)-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-(5-chloro-2-cyano-4-methylphenyl)-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168549836 |
| Molecular Formula | C15H11ClN4O2 |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | methyl 3-amino-1-(5-chloro-2-cyano-4-methylphenyl)-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cc(Cl)c(C)cc1C#N |
| InChI | InChI=1S/C15H11ClN4O2/c1-8-3-9(5-17)12(4-11(8)16)20-7-10(6-18)13(19)14(20)15(21)22-2/h3-4,7H,19H2,1-2H3 |
| InChIKey | UCYMPSAZHNUWKA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |