C13H9ClIN3O2 — CID 168511790
methyl 3-amino-1-(4-chloro-2-iodophenyl)-4-cyanopyrrole-2-carboxylate (PubChem CID 168511790) has the molecular formula C13H9ClIN3O2 and a molecular weight of 401.59 g/mol. Its IUPAC name is methyl 3-amino-1-(4-chloro-2-iodophenyl)-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-(4-chloro-2-iodophenyl)-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168511790 |
| Molecular Formula | C13H9ClIN3O2 |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 400.94 |
| IUPAC Name | methyl 3-amino-1-(4-chloro-2-iodophenyl)-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(Cl)cc1I |
| InChI | InChI=1S/C13H9ClIN3O2/c1-20-13(19)12-11(17)7(5-16)6-18(12)10-3-2-8(14)4-9(10)15/h2-4,6H,17H2,1H3 |
| InChIKey | KSRKTLLSMOGJJL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|