C13H10FN3O3 — CID 168545847
methyl 3-amino-4-cyano-1-(2-fluoro-5-hydroxyphenyl)pyrrole-2-carboxylate (PubChem CID 168545847) has the molecular formula C13H10FN3O3 and a molecular weight of 275.24 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(2-fluoro-5-hydroxyphenyl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(2-fluoro-5-hydroxyphenyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168545847 |
| Molecular Formula | C13H10FN3O3 |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(2-fluoro-5-hydroxyphenyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cc(O)ccc1F |
| InChI | InChI=1S/C13H10FN3O3/c1-20-13(19)12-11(16)7(5-15)6-17(12)10-4-8(18)2-3-9(10)14/h2-4,6,18H,16H2,1H3 |
| InChIKey | HBLIZKJDZUKQCR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |