C14H12FN3O4S — CID 168546393
methyl 3-amino-4-cyano-1-(2-fluoro-5-methylsulfonylphenyl)pyrrole-2-carboxylate (PubChem CID 168546393) has the molecular formula C14H12FN3O4S and a molecular weight of 337.33 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(2-fluoro-5-methylsulfonylphenyl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(2-fluoro-5-methylsulfonylphenyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168546393 |
| Molecular Formula | C14H12FN3O4S |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(2-fluoro-5-methylsulfonylphenyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C14H12FN3O4S/c1-22-14(19)13-12(17)8(6-16)7-18(13)11-5-9(23(2,20)21)3-4-10(11)15/h3-5,7H,17H2,1-2H3 |
| InChIKey | NOFHTXOFMFNFGS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 115.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |