C14H11ClFN3O2 — CID 168549597
methyl 3-amino-1-(2-chloro-4-fluoro-3-methylphenyl)-4-cyanopyrrole-2-carboxylate (PubChem CID 168549597) has the molecular formula C14H11ClFN3O2 and a molecular weight of 307.71 g/mol. Its IUPAC name is methyl 3-amino-1-(2-chloro-4-fluoro-3-methylphenyl)-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-(2-chloro-4-fluoro-3-methylphenyl)-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168549597 |
| Molecular Formula | C14H11ClFN3O2 |
| Molecular Weight | 307.71 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | methyl 3-amino-1-(2-chloro-4-fluoro-3-methylphenyl)-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(F)c(C)c1Cl |
| InChI | InChI=1S/C14H11ClFN3O2/c1-7-9(16)3-4-10(11(7)15)19-6-8(5-17)12(18)13(19)14(20)21-2/h3-4,6H,18H2,1-2H3 |
| InChIKey | XAAPXBBMHLDPMF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.71 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |