C13H10FN3O2S — CID 168548420
methyl 3-amino-4-cyano-1-(2-fluoro-4-sulfanylphenyl)pyrrole-2-carboxylate (PubChem CID 168548420) has the molecular formula C13H10FN3O2S and a molecular weight of 291.31 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(2-fluoro-4-sulfanylphenyl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(2-fluoro-4-sulfanylphenyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168548420 |
| Molecular Formula | C13H10FN3O2S |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(2-fluoro-4-sulfanylphenyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(S)cc1F |
| InChI | InChI=1S/C13H10FN3O2S/c1-19-13(18)12-11(16)7(5-15)6-17(12)10-3-2-8(20)4-9(10)14/h2-4,6,20H,16H2,1H3 |
| InChIKey | IEGTXIKVDJKZPU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|