C14H9FN4O2 — CID 168550111
methyl 3-amino-4-cyano-1-(4-cyano-2-fluorophenyl)pyrrole-2-carboxylate (PubChem CID 168550111) has the molecular formula C14H9FN4O2 and a molecular weight of 284.25 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(4-cyano-2-fluorophenyl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(4-cyano-2-fluorophenyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168550111 |
| Molecular Formula | C14H9FN4O2 |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(4-cyano-2-fluorophenyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(C#N)cc1F |
| InChI | InChI=1S/C14H9FN4O2/c1-21-14(20)13-12(18)9(6-17)7-19(13)11-3-2-8(5-16)4-10(11)15/h2-4,7H,18H2,1H3 |
| InChIKey | UHXBFUQVHMPADL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |