C15H9F3N4O3 — CID 168546362
methyl 3-amino-4-cyano-1-[4-cyano-2-(trifluoromethoxy)phenyl]pyrrole-2-carboxylate (PubChem CID 168546362) has the molecular formula C15H9F3N4O3 and a molecular weight of 350.26 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[4-cyano-2-(trifluoromethoxy)phenyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[4-cyano-2-(trifluoromethoxy)phenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168546362 |
| Molecular Formula | C15H9F3N4O3 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[4-cyano-2-(trifluoromethoxy)phenyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(C#N)cc1OC(F)(F)F |
| InChI | InChI=1S/C15H9F3N4O3/c1-24-14(23)13-12(21)9(6-20)7-22(13)10-3-2-8(5-19)4-11(10)25-15(16,17)18/h2-4,7H,21H2,1H3 |
| InChIKey | PGELQCKQAQLXGQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |