C16H13F3N4O3 — CID 168549309
methyl 1-[4-acetamido-2-(trifluoromethyl)phenyl]-3-amino-4-cyanopyrrole-2-carboxylate (PubChem CID 168549309) has the molecular formula C16H13F3N4O3 and a molecular weight of 366.30 g/mol. Its IUPAC name is methyl 1-[4-acetamido-2-(trifluoromethyl)phenyl]-3-amino-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 1-[4-acetamido-2-(trifluoromethyl)phenyl]-3-amino-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168549309 |
| Molecular Formula | C16H13F3N4O3 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | methyl 1-[4-acetamido-2-(trifluoromethyl)phenyl]-3-amino-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(NC(C)=O)cc1C(F)(F)F |
| InChI | InChI=1S/C16H13F3N4O3/c1-8(24)22-10-3-4-12(11(5-10)16(17,18)19)23-7-9(6-20)13(21)14(23)15(25)26-2/h3-5,7H,21H2,1-2H3,(H,22,24) |
| InChIKey | ODYWWLBALPPAOK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |