C14H9ClF3N3O2 — CID 168511777
methyl 3-amino-1-[2-chloro-4-(trifluoromethyl)phenyl]-4-cyanopyrrole-2-carboxylate (PubChem CID 168511777) has the molecular formula C14H9ClF3N3O2 and a molecular weight of 343.69 g/mol. Its IUPAC name is methyl 3-amino-1-[2-chloro-4-(trifluoromethyl)phenyl]-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-[2-chloro-4-(trifluoromethyl)phenyl]-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168511777 |
| Molecular Formula | C14H9ClF3N3O2 |
| Molecular Weight | 343.69 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | methyl 3-amino-1-[2-chloro-4-(trifluoromethyl)phenyl]-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H9ClF3N3O2/c1-23-13(22)12-11(20)7(5-19)6-21(12)10-3-2-8(4-9(10)15)14(16,17)18/h2-4,6H,20H2,1H3 |
| InChIKey | FJGBMFZZQFYGLP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.69 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |