C15H10Cl2F3N3O3 — CID 168547399
methyl 3-amino-1-[2-chloro-5-(2-chloro-1,1,2-trifluoroethoxy)phenyl]-4-cyanopyrrole-2-carboxylate (PubChem CID 168547399) has the molecular formula C15H10Cl2F3N3O3 and a molecular weight of 408.16 g/mol. Its IUPAC name is methyl 3-amino-1-[2-chloro-5-(2-chloro-1,1,2-trifluoroethoxy)phenyl]-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-[2-chloro-5-(2-chloro-1,1,2-trifluoroethoxy)phenyl]-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168547399 |
| Molecular Formula | C15H10Cl2F3N3O3 |
| Molecular Weight | 408.16 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | methyl 3-amino-1-[2-chloro-5-(2-chloro-1,1,2-trifluoroethoxy)phenyl]-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cc(OC(F)(F)C(F)Cl)ccc1Cl |
| InChI | InChI=1S/C15H10Cl2F3N3O3/c1-25-13(24)12-11(22)7(5-21)6-23(12)10-4-8(2-3-9(10)16)26-15(19,20)14(17)18/h2-4,6,14H,22H2,1H3 |
| InChIKey | XZLPRDRNRFHLFI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.16 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|