C14H10BrF2N3O3 — CID 168546118
methyl 3-amino-1-[2-bromo-4-(difluoromethoxy)phenyl]-4-cyanopyrrole-2-carboxylate (PubChem CID 168546118) has the molecular formula C14H10BrF2N3O3 and a molecular weight of 386.15 g/mol. Its IUPAC name is methyl 3-amino-1-[2-bromo-4-(difluoromethoxy)phenyl]-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-[2-bromo-4-(difluoromethoxy)phenyl]-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168546118 |
| Molecular Formula | C14H10BrF2N3O3 |
| Molecular Weight | 386.15 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | methyl 3-amino-1-[2-bromo-4-(difluoromethoxy)phenyl]-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(OC(F)F)cc1Br |
| InChI | InChI=1S/C14H10BrF2N3O3/c1-22-13(21)12-11(19)7(5-18)6-20(12)10-3-2-8(4-9(10)15)23-14(16)17/h2-4,6,14H,19H2,1H3 |
| InChIKey | JEUHDUCWHFHJOE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.15 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |