C15H13F2N3O3 — CID 168547865
methyl 3-amino-4-cyano-1-[2-(difluoromethoxy)-5-methylphenyl]pyrrole-2-carboxylate (PubChem CID 168547865) has the molecular formula C15H13F2N3O3 and a molecular weight of 321.28 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[2-(difluoromethoxy)-5-methylphenyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[2-(difluoromethoxy)-5-methylphenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168547865 |
| Molecular Formula | C15H13F2N3O3 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[2-(difluoromethoxy)-5-methylphenyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cc(C)ccc1OC(F)F |
| InChI | InChI=1S/C15H13F2N3O3/c1-8-3-4-11(23-15(16)17)10(5-8)20-7-9(6-18)12(19)13(20)14(21)22-2/h3-5,7,15H,19H2,1-2H3 |
| InChIKey | CZFKTXYBQPITGC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |