C15H12BrN3O4 — CID 168545783
methyl 3-amino-1-(2-bromo-4-methoxycarbonylphenyl)-4-cyanopyrrole-2-carboxylate (PubChem CID 168545783) has the molecular formula C15H12BrN3O4 and a molecular weight of 378.18 g/mol. Its IUPAC name is methyl 3-amino-1-(2-bromo-4-methoxycarbonylphenyl)-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-(2-bromo-4-methoxycarbonylphenyl)-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168545783 |
| Molecular Formula | C15H12BrN3O4 |
| Molecular Weight | 378.18 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | methyl 3-amino-1-(2-bromo-4-methoxycarbonylphenyl)-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1ccc(-n2cc(C#N)c(N)c2C(=O)OC)c(Br)c1 |
| InChI | InChI=1S/C15H12BrN3O4/c1-22-14(20)8-3-4-11(10(16)5-8)19-7-9(6-17)12(18)13(19)15(21)23-2/h3-5,7H,18H2,1-2H3 |
| InChIKey | QAXDLVBICWUEOK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.18 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |